Certainly! Here is a step-by-step solution for part **e** (rewritten in a similar style and structure as your provided examples): --- ### **e) Structure:** $CH_3-CH_2-C(OCH_3)_2-C(=CH_2)-O-CH_2-CH_3$ #### **Step 1: Identify the Parent Chain** - Look for the longest continuous chain that contains the **alkene** ($C=C$) functional group. - In this structure, the main chain has **5 carbons**. - The double bond ($C=CH_2$) is at the end, so the chain is a **pentene**. #### **Step 2: Number the Parent Chain** - Number the chain to give the double bond the **lowest possible number**. - Start from the **left** (the terminal $CH_3$ group): 1. $CH_3$ (C1) 2. $CH_2$ (C2) 3. $C(OCH_3)_2$ (C3) 4. $C(=CH_2)$ (C4) 5. $O-CH_2-CH_3$ (C5) - The double bond is between **C4 and C5**, but the $=CH_2$ is an exocyclic double bond at C4, making it a **pent-4-ene**. - However, if the chain is numbered from the **right** (the ethoxy group), the double bond is between C1 and C2 ($C(=CH_2)$ is at C1), making it **pent-1-ene**. - Always choose the numbering that gives the double bond the lowest number: **pent-1-ene**. #### **Step 3: Identify and Name the Substituents** - **At C2:** There is an **ethoxy** group ($-OCH_2CH_3$). - **At C3:** There are **two methoxy** groups ($-OCH_3$, $-OCH_3$), so it's called **3,3-dimethoxy**. #### **Step 4: Assemble the IUPAC Name** - List substituents in **alphabetical order**: ethoxy before dimethoxy. - Indicate their positions: - 2-ethoxy - 3,3-dimethoxy - pent-1-ene (parent chain with double bond at C1) --- #### **Final IUPAC Name:** **2-ethoxy-3,3-dimethoxypent-1-ene** --- **Summary Table:** | Position | Substituent | |----------|---------------------------| | 2 | ethoxy ($-OCH_2CH_3$) | | 3 | dimethoxy ($-OCH_3$, $-OCH_3$) | | 1 | start of double bond (alkene) | --- **Structure illustration (skeletal):** ``` CH3-CH2-C(OCH3)2-C(=CH2)-O-CH2CH3 ``` - [No image provided, but the structure is as above.] --- **Key Points:** - Parent chain: 5 carbons (pentene) - Double bond at carbon 1 (pent-1-ene) - Substituents: ethoxy at C2, two methoxy groups at C3 - Assemble name alphabetically: **2-ethoxy-3,3-dimethoxypent-1-ene**

Certainly! Here’s a rewritten solution for all parts in a similar structured format. --- ### **a) Structure:** 2,3-dimethylcyclooctanol #### **Step 1: Draw the Structure** 1. **Cyclooctanol:** Start with an 8-membered carbon ring (cyclooctane) and attach an $-OH$ (alcohol) group at position 1. 2. **2,3-dimethyl:** Attach two methyl ($-CH_3$) groups at carbon positions 2 and 3. #### **Final Structure:**  *Alt text: Structure of 2,3-dimethylcyclooctanol with OH group at position 1 and methyl groups at positions 2 and 3.* --- ### **b) Structure:** Ethyl Methyl Ether #### **Step 1: Draw the Structure** 1. **Ether:** Place an oxygen atom in the center. 2. **Ethyl Group:** Attach an ethyl group ($-CH_2CH_3$) to one side of the oxygen. 3. **Methyl Group:** Attach a methyl group ($-CH_3$) to the other side. #### **Final Structure:** **$CH_3CH_2-O-CH_3$** *Alt text: Structure of ethyl methyl ether showing ethyl and methyl groups attached to oxygen.* --- ### **c) Structure:** $CH_3-CH(O-CH_3)-CH_3$ #### **Step 1: Name the Compound** 1. **Parent Chain:** Identify the longest continuous chain, which is 3 carbons (propane). 2. **Substituent:** Note the $-O-CH_3$ (methoxy) group attached to carbon 2. 3. **Numbering:** The methoxy group is on carbon 2. #### **Final IUPAC Name:** **2-methoxypropane** *Alt text: Structure of 2-methoxypropane, showing propane chain with methoxy substituent.* --- ### **d) Structure:** $CH_3-C(CH_3)_2-O-CH(CH_3)-CH_3$ #### **Step 1: Name the Compound** 1. **Identify as Ether:** This compound is an ether with two bulky groups on the oxygen. 2. **Parent Chain:** Identify the longest chain, which is propan-2-yl from either side. 3. **Substituent:** The $O-C(CH_3)_3$ is a **tert-butoxy** group attached at position 2. #### **Final IUPAC Name:** **2-(tert-butoxy)propane** *Alt text: Structure of 2-(tert-butoxy)propane with tert-butoxy and propan-2-yl groups.* --- ### **e) Structure:** $CH_3-CH_2-C(OCH_3)_2-C(=CH_2)-O-CH_2-CH_3$ #### **Step 1: Identify the Parent Chain** - The longest chain that includes the alkene ($C=C$) has **5 carbons** (pentene). #### **Step 2: Number the Parent Chain** - Number from the left to give the double bond the lowest number: - C1: $CH_3$ - C2: $CH_2$ - C3: $C(OCH_3)_2$ - C4: $C(=CH_2)$ - C5: $O-CH_2-CH_3$ - The double bond is at C1, so it is **pent-1-ene**. #### **Step 3: Identify and Name Substituents** - **At C2:** Ethoxy group ($-O-CH_2-CH_3$). - **At C3:** Two methoxy groups ($-O-CH_3$, $-O-CH_3$), hence **3,3-dimethoxy**. #### **Step 4: Assemble the IUPAC Name** - Combine substituents alphabetically: - 2-ethoxy - 3,3-dimethoxy - pent-1-ene #### **Final IUPAC Name:** **2-ethoxy-3,3-dimethoxypent-1-ene** *Alt text: Structure of 2-ethoxy-3,3-dimethoxypent-1-ene with ethoxy and dimethoxy substituents.* --- ### **f) Structure:** $CH_3CH_2CH_2SH$ #### **Step 1: Name the Compound** 1. **Parent Chain:** The longest chain consists of 3 carbons (propane). 2. **Functional Group:** The $-SH$ group designates it as a **thiol**. 3. **Numbering:** The $-SH$ group is on carbon 1. #### **Final IUPAC Name:** **Propan-1-thiol** *Alt text: Structure of propan-1-thiol, showcasing the thiol group.* --- ### **g) Structure:** 3-pentanethiol #### **Step 1: Draw the Structure** 1. **Pentane:** Create a 5-carbon chain. 2. **3-thiol:** Attach an $-SH$ (thiol) group to the 3rd carbon. #### **Final Structure:** **$CH_3CH_2CH(SH)CH_2CH_3$** *Alt text: Structure of 3-pentanethiol with thiol group on the 3rd carbon.* --- This structured format provides a clear breakdown of each compound's structure, naming conventions, and relevant details without promotional language.