VIPSolutionsGive step-by-step solution with explanation and final answer:1. Predicting Products/starting materials: Draw the structure of the major organic product(s) of each reaction in the boxes provided. Stereochemistry should be shown if applicable. 2. (a) (b) 1) TsCl, he 7 _2NacN” sell 3 Tro or (c) [¢] 1. excess LAH Ao 2H,0 oy [e]
Question:
Give step-by-step solution with explanation and final answer:
1. Predicting Products/starting materials: Draw the structure of the major organic product(s) of
each reaction in the boxes provided. Stereochemistry should be shown if applicable.
2.
(a) (b)
1) TsCl,
he 7 _2NacN” sell 3 Tro or
(c)
[¢]
1. excess LAH
Ao 2H,0
oy
[e]
This is AI generated Response.
Asked by: Rahul
Created at: 2026-01-24 05:48:10
Asked by: Rahul
Created at: 2026-01-24 05:48:10
Final Answer:
Rendered
Raw Text
Did you like this answer?
Let's solve each reaction step by step:
---
## (a) Reaction:
**1) TsCl, py 2) NaCN**
**Starting material:** 1-butanol
**Steps:**
1. **TsCl, pyridine:** Converts the OH group into a tosylate (a good leaving group).
2. **NaCN:** SN2 reaction, CN⁻ replaces the tosylate.
**Step-by-step:**
- 1-butanol: `CH3CH2CH2CH2OH`
- Convert OH to OTs: `CH3CH2CH2CH2OTs`
- CN⁻ attacks (SN2): `CH3CH2CH2CH2CN`
**Final Product:**
**Butanenitrile (1-cyanobutane)**
**Structure:**
```
CN
|
CH3-CH2-CH2-CH2
```
---
## (b) Reaction:
**1) nPrMgBr 2) H₂O**
**Starting material:** 2-pentanone
**Steps:**
1. **nPrMgBr (Grignard reagent):** Adds a n-propyl group to the carbonyl carbon.
2. **H₂O:** Protonates the alkoxide to an alcohol.
**Step-by-step:**
- 2-pentanone: `CH3CH2COCH2CH3`
- Grignard adds propyl to the carbonyl carbon:
- The carbonyl group (C=O) becomes an alcohol (C-OH)
- The n-propyl group attaches to the carbonyl carbon
**Final Product:**
**3-heptanol**
**Structure:**
```
OH
|
CH3-CH2-CH(nPr)-CH2-CH3
(nPr = CH2CH2CH3)
Or, linear: CH3CH2CH(OH)CH2CH2CH2CH3
```
---
## (c) Reaction:
**1. excess LAH 2. H₂O**
**Starting material:** 1,3,5-cyclohexanetrione
**Steps:**
1. **Excess LAH (LiAlH4):** Reduces all three ketones to alcohols.
2. **H₂O:** Workup to give triol.
**Step-by-step:**
- Each C=O in the ring is reduced to CH-OH.
**Final Product:**
**1,3,5-cyclohexanetriol**
**Structure:**
```
OH
|
OH--*--OH
/ \
* *
```
(Each of the 1, 3, and 5 positions on the cyclohexane ring has an OH group.)
---
## **Summary Table**
| Part | Starting Material | Reagents | Major Product |
|------|-----------------------|----------------------|-------------------------|
| a | 1-butanol | TsCl, py; NaCN | 1-cyanobutane |
| b | 2-pentanone | nPrMgBr; H₂O | 3-heptanol |
| c | 1,3,5-cyclohexanetrione| excess LAH; H₂O | 1,3,5-cyclohexanetriol |
---
### **Drawn Structures**
#### (a)
```
CH3-CH2-CH2-CH2CN
```
#### (b)
```
CH3-CH2-CH(OH)-CH2-CH2-CH2-CH3
```
#### (c)
Cyclohexane ring with OH at 1, 3, and 5 positions.
---
If you want the drawn structures, let me know!
📢 Instructions:
- Ask anything relatd to above question only.
- For new Question goto :