## Synthesis Problem Explanation Let's break down the task and outline a **step-by-step synthesis** for **2,2,5-trimethyl-2-hexanol** using **2-methylpropanol** (also known as isobutanol, \( \ce{(CH3)2CHCH2OH} \)) as **the only carbon source**. --- ### **Step 1: Analyze the Target Molecule** #### **Target: 2,2,5-trimethyl-2-hexanol** - 6 carbons in the main chain (**hexanol**) - Three methyl groups at positions 2, 2, and 5 - Hydroxyl group at position 2 **Structure:** ``` CH3 | CH3-C(OH)-CH2-CH2-C(CH3)2-CH3 ``` - All carbons must come from **2-methylpropanol.** --- ### **Step 2: Analyze the Starting Material** #### **2-methylpropanol (isobutanol):** - Structure: \( \ce{(CH3)2CHCH2OH} \) - 4 carbons per molecule --- ### **Step 3: Strategy** - **Disassemble** 2-methylpropanol into useful fragments. - Use **C-C bond-forming reactions** (e.g., Grignard, alkylation). - Use functional group transformations to set up for these reactions. --- ### **Step 4: Synthetic Plan (Outline)** #### **1. Prepare Grignard Reagents** Convert 2-methylpropanol to **2-methylpropyl bromide** (\( \ce{(CH3)2CHCH2Br} \)), then to **Grignard reagent** (\( \ce{(CH3)2CHCH2MgBr} \)). #### **2. Build the Carbon Skeleton** - Use **Grignard addition** to carbonyl compounds (e.g., ketones/aldehydes) to assemble the hexanol skeleton with correct methyl substitutions. - You’ll need to **oxidize** some isobutanol to aldehyde/ketone intermediates for these steps. #### **3. Assemble the Target Structure** - Use **multiple equivalents** of the Grignard to build up the chain and introduce the necessary methyl groups. --- ### **Step 5: Step-by-Step Synthesis** #### **Step 1: Convert Isobutanol to Isobutyl Bromide** \[ \ce{(CH3)2CHCH2OH + PBr3 -> (CH3)2CHCH2Br} \] #### **Step 2: Make Grignard Reagent** \[ \ce{(CH3)2CHCH2Br + Mg -> (CH3)2CHCH2MgBr} \] #### **Step 3: Prepare 2-methylpropanal** Oxidize some isobutanol to **2-methylpropanal**: \[ \ce{(CH3)2CHCH2OH + [O] -> (CH3)2CHCHO} \] #### **Step 4: Grignard Addition** React the Grignard reagent with 2-methylpropanal: \[ \ce{(CH3)2CHCH2MgBr + (CH3)2CHCHO -> (CH3)2CHCH(OH)CH2CH(CH3)2} \] This gives a **5-carbon chain** with two methyl branches (still not quite there). #### **Step 5: Build to 6 Carbons** - Oxidize the alcohol obtained above to a ketone. - Add another equivalent of Grignard to this ketone to introduce the last methyl group. #### **Step 6: Final Product** After assembling and combining fragments, you will have: \[ \ce{2,2,5-trimethyl-2-hexanol} \] --- ## **Summary Table** | Step | Transformation | Purpose | |------|----------------|---------| | 1 | Isobutanol → Isobutyl bromide | Make alkyl halide | | 2 | Isobutyl bromide → Grignard | Prepare nucleophile | | 3 | Isobutanol → 2-methylpropanal | Make electrophile | | 4 | Grignard + aldehyde | Chain extension | | 5 | Oxidation to ketone | Prepare for more chain extension | | 6 | Grignard + ketone | Final skeleton assembly | | 7 | Workup | Isolate alcohol | --- ## **Key Takeaways** - **All carbon atoms must originate from isobutanol.** - Use **Grignard reactions** to build C–C bonds and assemble the desired substitution pattern. - Use **oxidation** and **reduction** as needed to convert between alcohols, aldehydes, and ketones. --- **Would you like to see the full reaction scheme with structures?**