Of course! Let's break down how to **draw the structures** for each of these organic compounds. I'll explain the naming and how to build each molecule step by step. --- ## a) 3-iodododecane - **Parent chain:** Dodecane (12 carbons, all single bonds) - **Substituent:** Iodo group on carbon 3 **Structure:** ``` CH3-CH2-CH(I)-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3 ``` Iodine (I) is attached to the 3rd carbon. --- ## b) 1-bromobutane - **Parent chain:** Butane (4 carbons) - **Substituent:** Bromo group on carbon 1 **Structure:** ``` Br-CH2-CH2-CH2-CH3 ``` Bromine (Br) is attached to the first carbon. --- ## c) 3-chloro-2,4-dimethylpentane - **Parent chain:** Pentane (5 carbons) - **Substituents:** - Chlorine on carbon 3 - Methyl groups on carbons 2 and 4 **Structure:** ``` CH3 | CH3-CH(CH3)-CH(Cl)-CH(CH3)-CH3 ``` - Carbon 2 and 4 each have a methyl (CH₃) group. - Carbon 3 has a chlorine (Cl). --- ## d) 4-ethyl-3-methylhex-2-ene - **Parent chain:** Hex-2-ene (6 carbons, double bond between C2 and C3) - **Substituents:** - Ethyl group on carbon 4 - Methyl group on carbon 3 **Structure:** ``` CH3-CH=CH(CH3)-CH(C2H5)-CH2-CH3 ``` - C3: methyl group - C4: ethyl group - Double bond between C2 and C3 --- ## e) 3-methylhepta-1,3,6-triene - **Parent chain:** Hepta (7 carbons) - **Double bonds:** Between C1–C2, C3–C4, C6–C7 - **Substituent:** Methyl group on carbon 3 **Structure:** ``` CH2=CH-C(CH3)=CH-CH2-CH=CH2 ``` - Methyl on C3 - Double bonds as specified --- ## f) (E)-oct-4-ene - **Parent chain:** Oct-4-ene (8 carbons, double bond between C4 and C5) - **Configuration:** (E) means the higher priority groups on opposite sides of the double bond **Structure (condensed):** ``` CH3-CH2-CH2-CH=CH-CH2-CH2-CH3 ``` - (E) isomer: The two largest groups on each end of the double bond are on opposite sides. --- ## g) 5-ethyl-3-methylhept-1-yne - **Parent chain:** Hept-1-yne (7 carbons, triple bond at C1) - **Substituents:** - Ethyl group on carbon 5 - Methyl group on carbon 3 **Structure:** ``` CH≡C-CH2-CH(CH3)-CH2-CH(C2H5)-CH3 ``` - Triple bond between C1 and C2 - Methyl at C3 - Ethyl at C5 --- If you'd like, I can draw these out for you or clarify any particular step!

# Summary of Organic Compounds Here’s a concise overview of the structures and key features of the organic compounds discussed: ## a) 3-iodododecane - **Parent Chain:** Dodecane (12 carbons) - **Substituent:** Iodo group on carbon 3 - **Structure:** `CH3-CH2-CH(I)-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3` ## b) 1-bromobutane - **Parent Chain:** Butane (4 carbons) - **Substituent:** Bromo group on carbon 1 - **Structure:** `Br-CH2-CH2-CH2-CH3` ## c) 3-chloro-2,4-dimethylpentane - **Parent Chain:** Pentane (5 carbons) - **Substituents:** - Chlorine on carbon 3 - Methyl groups on carbons 2 and 4 - **Structure:** ``` CH3 | CH3-CH(CH3)-CH(Cl)-CH(CH3)-CH3 ``` ## d) 4-ethyl-3-methylhex-2-ene - **Parent Chain:** Hex-2-ene (6 carbons, double bond between C2 and C3) - **Substituents:** - Ethyl group on carbon 4 - Methyl group on carbon 3 - **Structure:** `CH3-CH=CH(CH3)-CH(C2H5)-CH2-CH3` ## e) 3-methylhepta-1,3,6-triene - **Parent Chain:** Hepta (7 carbons) - **Double Bonds:** Between C1–C2, C3–C4, C6–C7 - **Substituent:** Methyl group on carbon 3 - **Structure:** `CH2=CH-C(CH3)=CH-CH2-CH=CH2` ## f) (E)-oct-4-ene - **Parent Chain:** Oct-4-ene (8 carbons, double bond between C4 and C5) - **Configuration:** (E), higher priority groups on opposite sides - **Structure:** `CH3-CH2-CH2-CH=CH-CH2-CH2-CH3` ## g) 5-ethyl-3-methylhept-1-yne - **Parent Chain:** Hept-1-yne (7 carbons, triple bond at C1) - **Substituents:** - Ethyl group on carbon 5 - Methyl group on carbon 3 - **Structure:** `CH≡C-CH2-CH(CH3)-CH2-CH(C2H5)-CH3` This summary provides a clear reference for understanding the structures and key features of each organic compound. Let me know if you need further assistance!